ChemNet > CAS > 175277-36-8 1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one
175277-36-8 1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one
نام محصول |
1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
مترادف |
1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethanone |
میدان مغناطیسی |
C11H7Cl2NO2 |
وزن مولکولی |
256.0848 |
InChI |
InChI=1/C11H7Cl2NO2/c1-6(15)11-5-10(14-16-11)7-2-3-8(12)9(13)4-7/h2-5H,1H3 |
شماره سیایاس |
175277-36-8 |
ساختار مولکولی |
|
تراکم |
1.375g/cm3 |
نقطه ذوب |
130℃ |
نقطه غلیان |
429.4°C at 760 mmHg |
ضریب شکست |
1.569 |
نقطه اشتعال |
213.5°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|